astrgir1 astrgir1
  • 02-06-2021
  • Mathematics
contestada

PLEASE HELP



what's x
cos(x+pi)-sin(x-pi)=0

please show work​

Respuesta :

Аноним Аноним
  • 02-06-2021

sin(x+pi)=-sin(x)=sin(-x)=cos(pi/2)

cos (x+pi)=-cos(x)

So according to the question:

cos(pi/2 +x)=cos(x)

Using the solution of cos, obtain:

(pi/2) + x = 2pi +- (x)

case#1: (pi/2) + x = 2pi + (x)

But here, the value of x is canceled, just

case#2: (pi/2) + x = 2pi - (x)

answer------------>>>>>>>>> x=pi-pi/4

Answer Link

Otras preguntas

Which of the following is true for all exergonic reactions? A) The products have more total energy than the reactants. B) The reaction proceeds with a net relea
Which material property is a major consideration when making water bottles?
determine if the ordered pair is a solution of the equation is (-1,-30) a solution of y =10×? true or false​
In the diagram find the m∠EFG. A) 20 degrees B) 30 degrees C) 40 degrees D) 80 degrees
Is this a linear function? Why or why not?
2.4=-t/4.5 what does t equal
Use the elimination method to solve the system of equations. Choose the correct pair
What are some possible cause of the cancer stomach?
What do organisms need in the space where they live?
This is a picture of a one-room house in South Carolina. (Picture below) Which social class MOST LIKELY lived in this kind of house? A) lower class B) small fa